C22H25Cl2FN2O2 — CID 77465563
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]propan-2-yl]acetamide (PubChem CID 77465563) has the molecular formula C22H25Cl2FN2O2 and a molecular weight of 439.36 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 77465563 |
| Molecular Formula | C22H25Cl2FN2O2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]propan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2ccc(CN3CCCC3)cc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C22H25Cl2FN2O2/c23-21(24)22(29)26-19(13-25)20(28)18-9-7-17(8-10-18)16-5-3-15(4-6-16)14-27-11-1-2-12-27/h3-10,19-21,28H,1-2,11-14H2,(H,26,29) |
| InChIKey | GNUFDJLQFRRPQE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|