C16H17Cl2FN2O2S — CID 123867789
N-[1-[4-[5-(aminomethyl)thiophen-3-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 123867789) has the molecular formula C16H17Cl2FN2O2S and a molecular weight of 391.30 g/mol. Its IUPAC name is N-[1-[4-[5-(aminomethyl)thiophen-3-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[4-[5-(aminomethyl)thiophen-3-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 123867789 |
| Molecular Formula | C16H17Cl2FN2O2S |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[1-[4-[5-(aminomethyl)thiophen-3-yl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | NCc1cc(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)cs1 |
| InChI | InChI=1S/C16H17Cl2FN2O2S/c17-15(18)16(23)21-13(6-19)14(22)10-3-1-9(2-4-10)11-5-12(7-20)24-8-11/h1-5,8,13-15,22H,6-7,20H2,(H,21,23) |
| InChIKey | YBIHTAMCOPYHKA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|