C16H14BrCl2FN2O2 — CID 88924293
N-[1-[4-(6-bromo-3-pyridinyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 88924293) has the molecular formula C16H14BrCl2FN2O2 and a molecular weight of 436.11 g/mol. Its IUPAC name is N-[1-[4-(6-bromo-3-pyridinyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[4-(6-bromo-3-pyridinyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 88924293 |
| Molecular Formula | C16H14BrCl2FN2O2 |
| Molecular Weight | 436.11 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | N-[1-[4-(6-bromo-3-pyridinyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2ccc(Br)nc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C16H14BrCl2FN2O2/c17-13-6-5-11(8-21-13)9-1-3-10(4-2-9)14(23)12(7-20)22-16(24)15(18)19/h1-6,8,12,14-15,23H,7H2,(H,22,24) |
| InChIKey | IJVCCIXNIGIYRG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.11 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|