C17H17Cl2FN2O2S — CID 142806653
N-[1-[4-(4-aminosulfanylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 142806653) has the molecular formula C17H17Cl2FN2O2S and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[1-[4-(4-aminosulfanylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[4-(4-aminosulfanylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 142806653 |
| Molecular Formula | C17H17Cl2FN2O2S |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | N-[1-[4-(4-aminosulfanylphenyl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | NSc1ccc(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C17H17Cl2FN2O2S/c18-16(19)17(24)22-14(9-20)15(23)12-3-1-10(2-4-12)11-5-7-13(25-21)8-6-11/h1-8,14-16,23H,9,21H2,(H,22,24) |
| InChIKey | PPCBDTBPDNBWTP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|