C15H19Cl2FN4O2 — CID 142806569
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[(1E)-1,4,4-triaminobuta-1,3-dien-2-yl]phenyl]propan-2-yl]acetamide (PubChem CID 142806569) has the molecular formula C15H19Cl2FN4O2 and a molecular weight of 377.25 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[(1E)-1,4,4-triaminobuta-1,3-dien-2-yl]phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[(1E)-1,4,4-triaminobuta-1,3-dien-2-yl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 142806569 |
| Molecular Formula | C15H19Cl2FN4O2 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[(1E)-1,4,4-triaminobuta-1,3-dien-2-yl]phenyl]propan-2-yl]acetamide |
| SMILES | N/C=C(\C=C(N)N)c1ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H19Cl2FN4O2/c16-14(17)15(24)22-11(6-18)13(23)9-3-1-8(2-4-9)10(7-19)5-12(20)21/h1-5,7,11,13-14,23H,6,19-21H2,(H,22,24)/b10-7+ |
| InChIKey | KDNYWFBLAOUVFW-JXMROGBWSA-N |
| XLogP | 1.04 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|