C13H14ClF2NO3 — CID 58631161
N-[(1R,2S)-1-(4-acetylphenyl)-3-fluoro-1-hydroxypropan-2-yl]-2-chloro-2-fluoroacetamide (PubChem CID 58631161) has the molecular formula C13H14ClF2NO3 and a molecular weight of 305.71 g/mol. Its IUPAC name is N-[(1R,2S)-1-(4-acetylphenyl)-3-fluoro-1-hydroxypropan-2-yl]-2-chloro-2-fluoroacetamide.
| Compound Name | N-[(1R,2S)-1-(4-acetylphenyl)-3-fluoro-1-hydroxypropan-2-yl]-2-chloro-2-fluoroacetamide |
|---|---|
| PubChem CID | 58631161 |
| Molecular Formula | C13H14ClF2NO3 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-[(1R,2S)-1-(4-acetylphenyl)-3-fluoro-1-hydroxypropan-2-yl]-2-chloro-2-fluoroacetamide |
| SMILES | CC(=O)c1ccc([C@@H](O)[C@@H](CF)NC(=O)C(F)Cl)cc1 |
| InChI | InChI=1S/C13H14ClF2NO3/c1-7(18)8-2-4-9(5-3-8)11(19)10(6-15)17-13(20)12(14)16/h2-5,10-12,19H,6H2,1H3,(H,17,20)/t10-,11-,12?/m1/s1 |
| InChIKey | VEONHKQDAQNDQE-XFKKCKKNSA-N |
| XLogP | 1.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|