C19H21Cl2FN2O4S — CID 78105315
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)phenyl]phenyl]propan-2-yl]acetamide (PubChem CID 78105315) has the molecular formula C19H21Cl2FN2O4S and a molecular weight of 463.36 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)phenyl]phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)phenyl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 78105315 |
| Molecular Formula | C19H21Cl2FN2O4S |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)phenyl]phenyl]propan-2-yl]acetamide |
| SMILES | CS(=O)(=O)NCc1ccc(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21Cl2FN2O4S/c1-29(27,28)23-11-12-2-4-13(5-3-12)14-6-8-15(9-7-14)17(25)16(10-22)24-19(26)18(20)21/h2-9,16-18,23,25H,10-11H2,1H3,(H,24,26) |
| InChIKey | FQDNBQWGQRGJFM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|