C15H18Cl2FN5O4S — CID 123907044
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)triazol-1-yl]phenyl]propan-2-yl]acetamide (PubChem CID 123907044) has the molecular formula C15H18Cl2FN5O4S and a molecular weight of 454.31 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)triazol-1-yl]phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)triazol-1-yl]phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 123907044 |
| Molecular Formula | C15H18Cl2FN5O4S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-[4-(methanesulfonamidomethyl)triazol-1-yl]phenyl]propan-2-yl]acetamide |
| SMILES | CS(=O)(=O)NCc1cn(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)nn1 |
| InChI | InChI=1S/C15H18Cl2FN5O4S/c1-28(26,27)19-7-10-8-23(22-21-10)11-4-2-9(3-5-11)13(24)12(6-18)20-15(25)14(16)17/h2-5,8,12-14,19,24H,6-7H2,1H3,(H,20,25) |
| InChIKey | FELYRBDNQNCAIB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|