C15H14Cl2FN3O2 — CID 10150184
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-pyridazin-3-ylphenyl)propan-2-yl]acetamide (PubChem CID 10150184) has the molecular formula C15H14Cl2FN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-pyridazin-3-ylphenyl)propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-pyridazin-3-ylphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 10150184 |
| Molecular Formula | C15H14Cl2FN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-pyridazin-3-ylphenyl)propan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2cccnn2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C15H14Cl2FN3O2/c16-14(17)15(23)20-12(8-18)13(22)10-5-3-9(4-6-10)11-2-1-7-19-21-11/h1-7,12-14,22H,8H2,(H,20,23) |
| InChIKey | QPSTVDDCWVGPOO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|