C15H13Cl3FN3O2 — CID 23570506
2,2-dichloro-N-[1-[4-(6-chloropyridazin-3-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]acetamide (PubChem CID 23570506) has the molecular formula C15H13Cl3FN3O2 and a molecular weight of 392.65 g/mol. Its IUPAC name is 2,2-dichloro-N-[1-[4-(6-chloropyridazin-3-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[1-[4-(6-chloropyridazin-3-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 23570506 |
| Molecular Formula | C15H13Cl3FN3O2 |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 2,2-dichloro-N-[1-[4-(6-chloropyridazin-3-yl)phenyl]-3-fluoro-1-hydroxypropan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2ccc(Cl)nn2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C15H13Cl3FN3O2/c16-12-6-5-10(21-22-12)8-1-3-9(4-2-8)13(23)11(7-19)20-15(24)14(17)18/h1-6,11,13-14,23H,7H2,(H,20,24) |
| InChIKey | VBGSTUIAZXXPOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|