C14H13Cl2FN2O3 — CID 23570499
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,2-oxazol-5-yl)phenyl]propan-2-yl]acetamide (PubChem CID 23570499) has the molecular formula C14H13Cl2FN2O3 and a molecular weight of 347.17 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,2-oxazol-5-yl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,2-oxazol-5-yl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 23570499 |
| Molecular Formula | C14H13Cl2FN2O3 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,2-oxazol-5-yl)phenyl]propan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2ccno2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C14H13Cl2FN2O3/c15-13(16)14(21)19-10(7-17)12(20)9-3-1-8(2-4-9)11-5-6-18-22-11/h1-6,10,12-13,20H,7H2,(H,19,21) |
| InChIKey | MOUWXVMIIVWTRK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|