C13H12Cl2FN3O2S — CID 10172443
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,3,4-thiadiazol-2-yl)phenyl]propan-2-yl]acetamide (PubChem CID 10172443) has the molecular formula C13H12Cl2FN3O2S and a molecular weight of 364.23 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,3,4-thiadiazol-2-yl)phenyl]propan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,3,4-thiadiazol-2-yl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 10172443 |
| Molecular Formula | C13H12Cl2FN3O2S |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-hydroxy-1-[4-(1,3,4-thiadiazol-2-yl)phenyl]propan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2nncs2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C13H12Cl2FN3O2S/c14-11(15)12(21)18-9(5-16)10(20)7-1-3-8(4-2-7)13-19-17-6-22-13/h1-4,6,9-11,20H,5H2,(H,18,21) |
| InChIKey | RFZTYKJSZITWSG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|