C18H19Cl2FN4O3 — CID 123677218
N-[1-[4-[6-[(carbamoylamino)methyl]-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide (PubChem CID 123677218) has the molecular formula C18H19Cl2FN4O3 and a molecular weight of 429.28 g/mol. Its IUPAC name is N-[1-[4-[6-[(carbamoylamino)methyl]-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-[4-[6-[(carbamoylamino)methyl]-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 123677218 |
| Molecular Formula | C18H19Cl2FN4O3 |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[1-[4-[6-[(carbamoylamino)methyl]-3-pyridinyl]phenyl]-3-fluoro-1-hydroxypropan-2-yl]-2,2-dichloroacetamide |
| SMILES | NC(=O)NCc1ccc(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)cn1 |
| InChI | InChI=1S/C18H19Cl2FN4O3/c19-16(20)17(27)25-14(7-21)15(26)11-3-1-10(2-4-11)12-5-6-13(23-8-12)9-24-18(22)28/h1-6,8,14-16,26H,7,9H2,(H,25,27)(H3,22,24,28) |
| InChIKey | HWRSZPFYHVEKLY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|