C19H18Cl2F2N2O3 — CID 123506839
2,2-dichloro-N-[3-fluoro-1-[4-[6-(3-fluorooxetan-3-yl)-3-pyridinyl]phenyl]-1-hydroxypropan-2-yl]acetamide (PubChem CID 123506839) has the molecular formula C19H18Cl2F2N2O3 and a molecular weight of 431.27 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-fluoro-1-[4-[6-(3-fluorooxetan-3-yl)-3-pyridinyl]phenyl]-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[3-fluoro-1-[4-[6-(3-fluorooxetan-3-yl)-3-pyridinyl]phenyl]-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 123506839 |
| Molecular Formula | C19H18Cl2F2N2O3 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2,2-dichloro-N-[3-fluoro-1-[4-[6-(3-fluorooxetan-3-yl)-3-pyridinyl]phenyl]-1-hydroxypropan-2-yl]acetamide |
| SMILES | O=C(NC(CF)C(O)c1ccc(-c2ccc(C3(F)COC3)nc2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C19H18Cl2F2N2O3/c20-17(21)18(27)25-14(7-22)16(26)12-3-1-11(2-4-12)13-5-6-15(24-8-13)19(23)9-28-10-19/h1-6,8,14,16-17,26H,7,9-10H2,(H,25,27) |
| InChIKey | QRLFLZQOUPNCNE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|