C14H16Cl2FNO5 — CID 58631122
2-hydroxyethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate (PubChem CID 58631122) has the molecular formula C14H16Cl2FNO5 and a molecular weight of 368.19 g/mol. Its IUPAC name is 2-hydroxyethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate.
| Compound Name | 2-hydroxyethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate |
|---|---|
| PubChem CID | 58631122 |
| Molecular Formula | C14H16Cl2FNO5 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 2-hydroxyethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate |
| SMILES | O=C(OCCO)c1ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H16Cl2FNO5/c15-12(16)13(21)18-10(7-17)11(20)8-1-3-9(4-2-8)14(22)23-6-5-19/h1-4,10-12,19-20H,5-7H2,(H,18,21)/t10-,11-/m1/s1 |
| InChIKey | WOOBHRNBLJYDFQ-GHMZBOCLSA-N |
| XLogP | 1.13 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|