C14H15Cl3FNO4 — CID 58631060
2-chloroethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate (PubChem CID 58631060) has the molecular formula C14H15Cl3FNO4 and a molecular weight of 386.63 g/mol. Its IUPAC name is 2-chloroethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate.
| Compound Name | 2-chloroethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate |
|---|---|
| PubChem CID | 58631060 |
| Molecular Formula | C14H15Cl3FNO4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-chloroethyl 4-[(1R,2S)-2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]benzoate |
| SMILES | O=C(OCCCl)c1ccc([C@@H](O)[C@@H](CF)NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H15Cl3FNO4/c15-5-6-23-14(22)9-3-1-8(2-4-9)11(20)10(7-18)19-13(21)12(16)17/h1-4,10-12,20H,5-7H2,(H,19,21)/t10-,11-/m1/s1 |
| InChIKey | KIRPRRFUWWSRGW-GHMZBOCLSA-N |
| XLogP | 2.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|