C21H25Cl2FN2O4S — CID 123895337
tert-butyl N-[[4-[4-[2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]phenyl]thiophen-2-yl]methyl]carbamate (PubChem CID 123895337) has the molecular formula C21H25Cl2FN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-[2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]phenyl]thiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-[2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]phenyl]thiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 123895337 |
| Molecular Formula | C21H25Cl2FN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | tert-butyl N-[[4-[4-[2-[(2,2-dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl]phenyl]thiophen-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(-c2ccc(C(O)C(CF)NC(=O)C(Cl)Cl)cc2)cs1 |
| InChI | InChI=1S/C21H25Cl2FN2O4S/c1-21(2,3)30-20(29)25-10-15-8-14(11-31-15)12-4-6-13(7-5-12)17(27)16(9-24)26-19(28)18(22)23/h4-8,11,16-18,27H,9-10H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | UNYVTWZBTFMSJU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|