C27H23FN2O3 — CID 68858700
ethyl 2-[6-cyano-3-[[2-(4-fluorophenoxy)phenyl]methyl]-2-methylindolizin-1-yl]acetate (PubChem CID 68858700) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is ethyl 2-[6-cyano-3-[[2-(4-fluorophenoxy)phenyl]methyl]-2-methylindolizin-1-yl]acetate.
| Compound Name | ethyl 2-[6-cyano-3-[[2-(4-fluorophenoxy)phenyl]methyl]-2-methylindolizin-1-yl]acetate |
|---|---|
| PubChem CID | 68858700 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | ethyl 2-[6-cyano-3-[[2-(4-fluorophenoxy)phenyl]methyl]-2-methylindolizin-1-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(Cc2ccccc2Oc2ccc(F)cc2)n2cc(C#N)ccc12 |
| InChI | InChI=1S/C27H23FN2O3/c1-3-32-27(31)15-23-18(2)25(30-17-19(16-29)8-13-24(23)30)14-20-6-4-5-7-26(20)33-22-11-9-21(28)10-12-22/h4-13,17H,3,14-15H2,1-2H3 |
| InChIKey | GAUNLJIJYYWPJQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |