C25H20N2O4S — CID 68860343
2-[3-[benzenesulfonyl(phenyl)methyl]-6-cyano-2-methylindolizin-1-yl]acetic acid (PubChem CID 68860343) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-[3-[benzenesulfonyl(phenyl)methyl]-6-cyano-2-methylindolizin-1-yl]acetic acid.
| Compound Name | 2-[3-[benzenesulfonyl(phenyl)methyl]-6-cyano-2-methylindolizin-1-yl]acetic acid |
|---|---|
| PubChem CID | 68860343 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[3-[benzenesulfonyl(phenyl)methyl]-6-cyano-2-methylindolizin-1-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2ccc(C#N)cn2c1C(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O4S/c1-17-21(14-23(28)29)22-13-12-18(15-26)16-27(22)24(17)25(19-8-4-2-5-9-19)32(30,31)20-10-6-3-7-11-20/h2-13,16,25H,14H2,1H3,(H,28,29) |
| InChIKey | ZGLFTRRSUBZRAE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |