C20H19NO3S — CID 89119053
4-[1-(benzenesulfonyl)-3-ethyl-2-hydroxypent-4-ynyl]benzonitrile (PubChem CID 89119053) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-3-ethyl-2-hydroxypent-4-ynyl]benzonitrile.
| Compound Name | 4-[1-(benzenesulfonyl)-3-ethyl-2-hydroxypent-4-ynyl]benzonitrile |
|---|---|
| PubChem CID | 89119053 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-3-ethyl-2-hydroxypent-4-ynyl]benzonitrile |
| SMILES | C#CC(CC)C(O)C(c1ccc(C#N)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3S/c1-3-16(4-2)19(22)20(17-12-10-15(14-21)11-13-17)25(23,24)18-8-6-5-7-9-18/h1,5-13,16,19-20,22H,4H2,2H3 |
| InChIKey | IMYXUOJBNGAQCW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|