C31H31NO7S2 — CID 123305757
1-(benzenesulfonyl)-1-(4-methoxyphenyl)pent-4-yn-2-ol;3-(2-hydroxy-1-methylsulfonylpent-4-ynyl)benzonitrile (PubChem CID 123305757) has the molecular formula C31H31NO7S2 and a molecular weight of 593.72 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1-(4-methoxyphenyl)pent-4-yn-2-ol;3-(2-hydroxy-1-methylsulfonylpent-4-ynyl)benzonitrile.
| Compound Name | 1-(benzenesulfonyl)-1-(4-methoxyphenyl)pent-4-yn-2-ol;3-(2-hydroxy-1-methylsulfonylpent-4-ynyl)benzonitrile |
|---|---|
| PubChem CID | 123305757 |
| Molecular Formula | C31H31NO7S2 |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 1-(benzenesulfonyl)-1-(4-methoxyphenyl)pent-4-yn-2-ol;3-(2-hydroxy-1-methylsulfonylpent-4-ynyl)benzonitrile |
| SMILES | C#CCC(O)C(c1ccc(OC)cc1)S(=O)(=O)c1ccccc1.C#CCC(O)C(c1cccc(C#N)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H18O4S.C13H13NO3S/c1-3-7-17(19)18(14-10-12-15(22-2)13-11-14)23(20,21)16-8-5-4-6-9-16;1-3-5-12(15)13(18(2,16)17)11-7-4-6-10(8-11)9-14/h1,4-6,8-13,17-19H,7H2,2H3;1,4,6-8,12-13,15H,5H2,2H3 |
| InChIKey | LSFYJWZTBKYYSR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|