About 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate
3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate (PubChem CID 21234424) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate |
| PubChem CID | 21234424 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccn2)c2ccc(C(=O)OC)cn12 |
| InChI | InChI=1S/C18H16N2O4/c1-3-24-18(22)16-10-13(14-6-4-5-9-19-14)15-8-7-12(11-20(15)16)17(21)23-2/h4-11H,3H2,1-2H3 |
| InChIKey | AHEHKVADPHCHBZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate?
The IUPAC name of 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate (CID 21234424) is 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate.
What is the SMILES notation for 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate?
The canonical SMILES for 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate is CCOC(=O)c1cc(-c2ccccn2)c2ccc(C(=O)OC)cn12.
What is the InChIKey of 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate?
The InChIKey is AHEHKVADPHCHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-3-24-18(22)16-10-13(14-6-4-5-9-19-14)15-8-7-12(11-20(15)16)17(21)23-2/h4-11H,3H2,1-2H3.
What are the key properties of 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate?
3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate has a molecular weight of 324.34 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate is sourced from PubChem (CID 21234424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).