C18H16N2O4 — CID 21234424
3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate (PubChem CID 21234424) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 21234424 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-O-ethyl 6-O-methyl 1-pyridin-2-ylindolizine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccn2)c2ccc(C(=O)OC)cn12 |
| InChI | InChI=1S/C18H16N2O4/c1-3-24-18(22)16-10-13(14-6-4-5-9-19-14)15-8-7-12(11-20(15)16)17(21)23-2/h4-11H,3H2,1-2H3 |
| InChIKey | AHEHKVADPHCHBZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |