C18H15NO6 — CID 628301
trimethyl pyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate (PubChem CID 628301) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is trimethyl pyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate.
| Compound Name | trimethyl pyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 628301 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | trimethyl pyrrolo[2,1-a]isoquinoline-1,2,3-tricarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2c3ccccc3ccn2c1C(=O)OC |
| InChI | InChI=1S/C18H15NO6/c1-23-16(20)12-13(17(21)24-2)15(18(22)25-3)19-9-8-10-6-4-5-7-11(10)14(12)19/h4-9H,1-3H3 |
| InChIKey | LBIZAJRRCYJCDI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|