About 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate
2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate (PubChem CID 122188472) has the molecular formula C23H21N3O4
and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
| PubChem CID | 122188472 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
| SMILES | O=C1c2cccnc2C(=O)c2c1c(C(=O)OCCN1CCCCC1)c1ccccn21 |
| InChI | InChI=1S/C23H21N3O4/c27-21-15-7-6-9-24-19(15)22(28)20-18(21)17(16-8-2-5-12-26(16)20)23(29)30-14-13-25-10-3-1-4-11-25/h2,5-9,12H,1,3-4,10-11,13-14H2 |
| InChIKey | OATANYSNZPXVHP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate?
The IUPAC name of 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate (CID 122188472) is 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate.
What is the SMILES notation for 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate?
The canonical SMILES for 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate is O=C1c2cccnc2C(=O)c2c1c(C(=O)OCCN1CCCCC1)c1ccccn21.
What is the InChIKey of 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate?
The InChIKey is OATANYSNZPXVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O4/c27-21-15-7-6-9-24-19(15)22(28)20-18(21)17(16-8-2-5-12-26(16)20)23(29)30-14-13-25-10-3-1-4-11-25/h2,5-9,12H,1,3-4,10-11,13-14H2.
What are the key properties of 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate?
2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate has a molecular weight of 403.44 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate is sourced from PubChem (CID 122188472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).