C23H15N3O4 — CID 122188471
2-pyridin-2-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate (PubChem CID 122188471) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate.
| Compound Name | 2-pyridin-2-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 122188471 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-pyridin-2-ylethyl 5,12-dioxoindolizino[2,3-g]quinoline-6-carboxylate |
| SMILES | O=C1c2cccnc2C(=O)c2c1c(C(=O)OCCc1ccccn1)c1ccccn21 |
| InChI | InChI=1S/C23H15N3O4/c27-21-15-7-5-11-25-19(15)22(28)20-18(21)17(16-8-2-4-12-26(16)20)23(29)30-13-9-14-6-1-3-10-24-14/h1-8,10-12H,9,13H2 |
| InChIKey | XHSLXZCUAQQCEJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|