C21H13N3O3 — CID 11100338
ethyl 8-oxo-6,10,20-triazapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene-4-carboxylate (PubChem CID 11100338) has the molecular formula C21H13N3O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is ethyl 8-oxo-6,10,20-triazapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene-4-carboxylate.
| Compound Name | ethyl 8-oxo-6,10,20-triazapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene-4-carboxylate |
|---|---|
| PubChem CID | 11100338 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | ethyl 8-oxo-6,10,20-triazapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene-4-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)-c1nc3ccccc3c3ccnc(c13)C2=O |
| InChI | InChI=1S/C21H13N3O3/c1-2-27-21(26)11-9-14-17-16-13(12-5-3-4-6-15(12)24-17)7-8-22-19(16)20(25)18(14)23-10-11/h3-10H,2H2,1H3 |
| InChIKey | NJGLKAOBESXCHS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|