C18H18N2O2S — CID 70169705
ethyl 2-(1-benzylsulfanylimidazo[1,5-a]pyridin-3-yl)acetate (PubChem CID 70169705) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is ethyl 2-(1-benzylsulfanylimidazo[1,5-a]pyridin-3-yl)acetate.
| Compound Name | ethyl 2-(1-benzylsulfanylimidazo[1,5-a]pyridin-3-yl)acetate |
|---|---|
| PubChem CID | 70169705 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl 2-(1-benzylsulfanylimidazo[1,5-a]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)Cc1nc(SCc2ccccc2)c2ccccn12 |
| InChI | InChI=1S/C18H18N2O2S/c1-2-22-17(21)12-16-19-18(15-10-6-7-11-20(15)16)23-13-14-8-4-3-5-9-14/h3-11H,2,12-13H2,1H3 |
| InChIKey | VISISNBZTJVSPC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |