C22H23N3O4S2 — CID 69122629
ethyl 2-[7-cyano-1-[4-(ethylsulfonylamino)phenyl]sulfanyl-2-methylindolizin-3-yl]acetate (PubChem CID 69122629) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is ethyl 2-[7-cyano-1-[4-(ethylsulfonylamino)phenyl]sulfanyl-2-methylindolizin-3-yl]acetate.
| Compound Name | ethyl 2-[7-cyano-1-[4-(ethylsulfonylamino)phenyl]sulfanyl-2-methylindolizin-3-yl]acetate |
|---|---|
| PubChem CID | 69122629 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | ethyl 2-[7-cyano-1-[4-(ethylsulfonylamino)phenyl]sulfanyl-2-methylindolizin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)c(Sc2ccc(NS(=O)(=O)CC)cc2)c2cc(C#N)ccn12 |
| InChI | InChI=1S/C22H23N3O4S2/c1-4-29-21(26)13-19-15(3)22(20-12-16(14-23)10-11-25(19)20)30-18-8-6-17(7-9-18)24-31(27,28)5-2/h6-12,24H,4-5,13H2,1-3H3 |
| InChIKey | YLYWJJQAMTXVFO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |