About propyl 2-(3-iodophenyl)acetate
propyl 2-(3-iodophenyl)acetate (PubChem CID 139697967) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is propyl 2-(3-iodophenyl)acetate.
Molecular Properties
| Compound Name | propyl 2-(3-iodophenyl)acetate |
| PubChem CID | 139697967 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | propyl 2-(3-iodophenyl)acetate |
| SMILES | CCCOC(=O)Cc1cccc(I)c1 |
| InChI | InChI=1S/C11H13IO2/c1-2-6-14-11(13)8-9-4-3-5-10(12)7-9/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | NBMMBYIQYVAVRO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propyl 2-(3-iodophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-(3-iodophenyl)acetate?
The IUPAC name of propyl 2-(3-iodophenyl)acetate (CID 139697967) is propyl 2-(3-iodophenyl)acetate.
What is the SMILES notation for propyl 2-(3-iodophenyl)acetate?
The canonical SMILES for propyl 2-(3-iodophenyl)acetate is CCCOC(=O)Cc1cccc(I)c1.
What is the InChIKey of propyl 2-(3-iodophenyl)acetate?
The InChIKey is NBMMBYIQYVAVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO2/c1-2-6-14-11(13)8-9-4-3-5-10(12)7-9/h3-5,7H,2,6,8H2,1H3.
What are the key properties of propyl 2-(3-iodophenyl)acetate?
propyl 2-(3-iodophenyl)acetate has a molecular weight of 304.13 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-(3-iodophenyl)acetate is sourced from PubChem (CID 139697967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).