C26H25F3N4O3 — CID 151106062
ethyl 2-[7-[5-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate (PubChem CID 151106062) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is ethyl 2-[7-[5-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate.
| Compound Name | ethyl 2-[7-[5-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
|---|---|
| PubChem CID | 151106062 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | ethyl 2-[7-[5-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
| SMILES | CCOC(=O)Cc1c2n(c3ccccc13)CC(n1nncc1C(O)(c1ccccc1)C(F)(F)F)CC2 |
| InChI | InChI=1S/C26H25F3N4O3/c1-2-36-24(34)14-20-19-10-6-7-11-21(19)32-16-18(12-13-22(20)32)33-23(15-30-31-33)25(35,26(27,28)29)17-8-4-3-5-9-17/h3-11,15,18,35H,2,12-14,16H2,1H3 |
| InChIKey | MPDBEVIGPBGKEN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|