C19H20FN4O2P — CID 90760332
2-[4-fluoro-7-[5-(2-methylphosphanylideneethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 90760332) has the molecular formula C19H20FN4O2P and a molecular weight of 386.37 g/mol. Its IUPAC name is 2-[4-fluoro-7-[5-(2-methylphosphanylideneethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[4-fluoro-7-[5-(2-methylphosphanylideneethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 90760332 |
| Molecular Formula | C19H20FN4O2P |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-[4-fluoro-7-[5-(2-methylphosphanylideneethyl)triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | C/P=C/Cc1cnnn1C1CCc2c(CC(=O)O)c3cccc(F)c3n2C1 |
| InChI | InChI=1S/C19H20FN4O2P/c1-27-8-7-12-10-21-22-24(12)13-5-6-17-15(9-18(25)26)14-3-2-4-16(20)19(14)23(17)11-13/h2-4,8,10,13H,5-7,9,11H2,1H3,(H,25,26) |
| InChIKey | ZGNCOMQEUZYLHC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|