C24H29FNO3 — CID 145226823
CID 145226823 (PubChem CID 145226823) has the molecular formula C24H29FNO3 and a molecular weight of 398.50 g/mol.
| Compound Name | CID 145226823 |
|---|---|
| PubChem CID | 145226823 |
| Molecular Formula | C24H29FNO3 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | — |
| SMILES | CC.CC(=O)Cc1c2n(c3c(F)cccc13)C(C(=O)C1=C[CH]1)C(=O)CC2.CCC |
| InChI | InChI=1S/C19H15FNO3.C3H8.C2H6/c1-10(22)9-13-12-3-2-4-14(20)17(12)21-15(13)7-8-16(23)18(21)19(24)11-5-6-11;1-3-2;1-2/h2-6,18H,7-9H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | RKYJBQZPMJBRCB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|