C25H26N4O3 — CID 46891998
2-[7-[4-[4-(2-hydroxypropan-2-yl)phenyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 46891998) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[7-[4-[4-(2-hydroxypropan-2-yl)phenyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[7-[4-[4-(2-hydroxypropan-2-yl)phenyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 46891998 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[7-[4-[4-(2-hydroxypropan-2-yl)phenyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | CC(C)(O)c1ccc(-c2cn(C3CCc4c(CC(=O)O)c5ccccc5n4C3)nn2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-25(2,32)17-9-7-16(8-10-17)21-15-29(27-26-21)18-11-12-23-20(13-24(30)31)19-5-3-4-6-22(19)28(23)14-18/h3-10,15,18,32H,11-14H2,1-2H3,(H,30,31) |
| InChIKey | AOYPXMFWCAVASX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|