About sulfanyl 2-phenylpentanoate
sulfanyl 2-phenylpentanoate (PubChem CID 174681002) has the molecular formula C11H14O2S
and a molecular weight of 210.30 g/mol. Its IUPAC name is sulfanyl 2-phenylpentanoate.
Molecular Properties
| Compound Name | sulfanyl 2-phenylpentanoate |
| PubChem CID | 174681002 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | sulfanyl 2-phenylpentanoate |
| SMILES | CCCC(C(=O)OS)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S/c1-2-6-10(11(12)13-14)9-7-4-3-5-8-9/h3-5,7-8,10,14H,2,6H2,1H3 |
| InChIKey | PHKBLTUYCLDWGH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfanyl 2-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfanyl 2-phenylpentanoate?
The IUPAC name of sulfanyl 2-phenylpentanoate (CID 174681002) is sulfanyl 2-phenylpentanoate.
What is the SMILES notation for sulfanyl 2-phenylpentanoate?
The canonical SMILES for sulfanyl 2-phenylpentanoate is CCCC(C(=O)OS)c1ccccc1.
What is the InChIKey of sulfanyl 2-phenylpentanoate?
The InChIKey is PHKBLTUYCLDWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S/c1-2-6-10(11(12)13-14)9-7-4-3-5-8-9/h3-5,7-8,10,14H,2,6H2,1H3.
What are the key properties of sulfanyl 2-phenylpentanoate?
sulfanyl 2-phenylpentanoate has a molecular weight of 210.30 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfanyl 2-phenylpentanoate is sourced from PubChem (CID 174681002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).