C19H18O3 — CID 140640221
1,4-diphenylheptane-1,2,3-trione (PubChem CID 140640221) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1,4-diphenylheptane-1,2,3-trione.
| Compound Name | 1,4-diphenylheptane-1,2,3-trione |
|---|---|
| PubChem CID | 140640221 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1,4-diphenylheptane-1,2,3-trione |
| SMILES | CCCC(C(=O)C(=O)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-2-9-16(14-10-5-3-6-11-14)18(21)19(22)17(20)15-12-7-4-8-13-15/h3-8,10-13,16H,2,9H2,1H3 |
| InChIKey | YTHCECWHRVFBDW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|