C43H34S — CID 146269845
4-[10-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dihydroanthracen-9-yl]-6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]dibenzothiophene (PubChem CID 146269845) has the molecular formula C43H34S and a molecular weight of 582.81 g/mol. Its IUPAC name is 4-[10-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dihydroanthracen-9-yl]-6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]dibenzothiophene.
| Compound Name | 4-[10-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dihydroanthracen-9-yl]-6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 146269845 |
| Molecular Formula | C43H34S |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | 4-[10-[(3Z)-hexa-1,3,5-trien-2-yl]-1,2-dihydroanthracen-9-yl]-6-[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]dibenzothiophene |
| SMILES | C=C/C=C\C(=C)c1c2c(c(-c3cccc4c3sc3c(-c5ccc(/C=C\C=C/C)cc5)cccc34)c3ccccc13)CCC=C2 |
| InChI | InChI=1S/C43H34S/c1-4-6-8-16-30-25-27-31(28-26-30)32-21-13-22-37-38-23-14-24-39(43(38)44-42(32)37)41-35-19-11-9-17-33(35)40(29(3)15-7-5-2)34-18-10-12-20-36(34)41/h4-11,13-19,21-28H,2-3,12,20H2,1H3/b6-4-,15-7-,16-8- |
| InChIKey | FVNJAXQPVUHCRL-NWZFNSCVSA-N |
| XLogP | 12.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|