C43H32O — CID 155199860
3-[10-[4-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]phenyl]-1,2-dihydroanthracen-9-yl]dibenzofuran (PubChem CID 155199860) has the molecular formula C43H32O and a molecular weight of 564.73 g/mol. Its IUPAC name is 3-[10-[4-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]phenyl]-1,2-dihydroanthracen-9-yl]dibenzofuran.
| Compound Name | 3-[10-[4-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]phenyl]-1,2-dihydroanthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 155199860 |
| Molecular Formula | C43H32O |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 3-[10-[4-[(1Z,2Z)-1-cyclohexa-2,4-dien-1-ylidenepenta-2,4-dienyl]phenyl]-1,2-dihydroanthracen-9-yl]dibenzofuran |
| SMILES | C=C/C=C\C(=C1\C=CC=CC1)c1ccc(-c2c3c(c(-c4ccc5c(c4)oc4ccccc45)c4ccccc24)CCC=C3)cc1 |
| InChI | InChI=1S/C43H32O/c1-2-3-15-33(29-13-5-4-6-14-29)30-22-24-31(25-23-30)42-36-17-7-9-19-38(36)43(39-20-10-8-18-37(39)42)32-26-27-35-34-16-11-12-21-40(34)44-41(35)28-32/h2-9,11-13,15-19,21-28H,1,10,14,20H2/b15-3-,33-29+ |
| InChIKey | DAMJZIUJGTUQOB-LVWAQBONSA-N |
| XLogP | 12.04 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|