C39H32S — CID 142406124
8-(9,9-dimethylfluoren-2-yl)-7-[4-[(1Z,3Z)-hexa-1,3,5-trienyl]phenyl]-3,4-dihydrodibenzothiophene (PubChem CID 142406124) has the molecular formula C39H32S and a molecular weight of 532.75 g/mol. Its IUPAC name is 8-(9,9-dimethylfluoren-2-yl)-7-[4-[(1Z,3Z)-hexa-1,3,5-trienyl]phenyl]-3,4-dihydrodibenzothiophene.
| Compound Name | 8-(9,9-dimethylfluoren-2-yl)-7-[4-[(1Z,3Z)-hexa-1,3,5-trienyl]phenyl]-3,4-dihydrodibenzothiophene |
|---|---|
| PubChem CID | 142406124 |
| Molecular Formula | C39H32S |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 8-(9,9-dimethylfluoren-2-yl)-7-[4-[(1Z,3Z)-hexa-1,3,5-trienyl]phenyl]-3,4-dihydrodibenzothiophene |
| SMILES | C=C/C=C\C=C/c1ccc(-c2cc3sc4c(c3cc2-c2ccc3c(c2)C(C)(C)c2ccccc2-3)C=CCC4)cc1 |
| InChI | InChI=1S/C39H32S/c1-4-5-6-7-12-26-17-19-27(20-18-26)33-25-38-34(31-14-9-11-16-37(31)40-38)24-32(33)28-21-22-30-29-13-8-10-15-35(29)39(2,3)36(30)23-28/h4-10,12-15,17-25H,1,11,16H2,2-3H3/b6-5-,12-7- |
| InChIKey | TWNQZWCMJHZVED-VZVVJSHISA-N |
| XLogP | 11.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|