C63H49N3 — CID 91027593
5-[(4E)-8-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-4-(4-phenylphenyl)-1,6-dihydro-1,3-diazocin-2-yl]-7,7-dimethyl-1,3-diphenylindeno[2,1-b]carbazole (PubChem CID 91027593) has the molecular formula C63H49N3 and a molecular weight of 848.11 g/mol. Its IUPAC name is 5-[(4E)-8-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-4-(4-phenylphenyl)-1,6-dihydro-1,3-diazocin-2-yl]-7,7-dimethyl-1,3-diphenylindeno[2,1-b]carbazole.
| Compound Name | 5-[(4E)-8-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-4-(4-phenylphenyl)-1,6-dihydro-1,3-diazocin-2-yl]-7,7-dimethyl-1,3-diphenylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 91027593 |
| Molecular Formula | C63H49N3 |
| Molecular Weight | 848.11 g/mol |
| Exact Mass | 847.39 |
| IUPAC Name | 5-[(4E)-8-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-4-(4-phenylphenyl)-1,6-dihydro-1,3-diazocin-2-yl]-7,7-dimethyl-1,3-diphenylindeno[2,1-b]carbazole |
| SMILES | C=C/C=C\C=C\c1ccc(C2=CC/C=C(c3ccc(-c4ccccc4)cc3)\N=C(\n3c4cc5c(cc4c4c(-c6ccccc6)cc(-c6ccccc6)cc43)-c3ccccc3C5(C)C)N2)cc1 |
| InChI | InChI=1S/C63H49N3/c1-4-5-6-10-20-43-31-33-48(34-32-43)57-29-19-30-58(49-37-35-46(36-38-49)44-21-11-7-12-22-44)65-62(64-57)66-59-42-56-53(51-27-17-18-28-55(51)63(56,2)3)41-54(59)61-52(47-25-15-9-16-26-47)39-50(40-60(61)66)45-23-13-8-14-24-45/h4-18,20-42H,1,19H2,2-3H3,(H,64,65)/b6-5-,20-10+,57-29?,58-30- |
| InChIKey | PYEITTZFJISIOB-YHNZDBRYSA-N |
| XLogP | 16.14 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.11 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|