C49H42BN4O2 — CID 174084398
CID 174084398 (PubChem CID 174084398) has the molecular formula C49H42BN4O2 and a molecular weight of 729.71 g/mol.
| Compound Name | CID 174084398 |
|---|---|
| PubChem CID | 174084398 |
| Molecular Formula | C49H42BN4O2 |
| Molecular Weight | 729.71 g/mol |
| Exact Mass | 729.34 |
| IUPAC Name | — |
| SMILES | C=C/C=C\C(=C)c1nc(/C(C)=C/C(=C\C)c2cccc3c2oc2c(-c4ccc5c(c4)C(C)(C)c4ccc6ncoc6c4-5)cccc23)nc(C(/C=C\C)=C/[B]C)n1 |
| InChI | InChI=1S/C49H42BN4O2/c1-9-12-16-29(4)46-52-47(54-48(53-46)33(15-10-2)27-50-8)30(5)25-31(11-3)34-17-13-19-36-37-20-14-18-35(44(37)56-43(34)36)32-21-22-38-40(26-32)49(6,7)39-23-24-41-45(42(38)39)55-28-51-41/h9-28H,1,4H2,2-3,5-8H3/b15-10-,16-12-,30-25+,31-11+,33-27+ |
| InChIKey | RAXKSOVINHWXEW-AMCGTNDWSA-N |
| XLogP | 12.82 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.71 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|