C49H32N4O2 — CID 168832486
8-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-2-phenyl-6,6-bis(trideuteriomethyl)indeno[2,1-g][1,3]benzoxazole (PubChem CID 168832486) has the molecular formula C49H32N4O2 and a molecular weight of 714.86 g/mol. Its IUPAC name is 8-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-2-phenyl-6,6-bis(trideuteriomethyl)indeno[2,1-g][1,3]benzoxazole.
| Compound Name | 8-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-2-phenyl-6,6-bis(trideuteriomethyl)indeno[2,1-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 168832486 |
| Molecular Formula | C49H32N4O2 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | 8-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-4-yl]-2-phenyl-6,6-bis(trideuteriomethyl)indeno[2,1-g][1,3]benzoxazole |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2cc(-c3cccc4c3oc3c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cccc34)ccc2-c2c1ccc1nc(-c3ccccc3)oc21 |
| InChI | InChI=1S/C49H32N4O2/c1-49(2)38-26-27-40-44(55-48(50-40)31-18-10-5-11-19-31)41(38)36-25-24-32(28-39(36)49)33-20-12-21-34-35-22-13-23-37(43(35)54-42(33)34)47-52-45(29-14-6-3-7-15-29)51-46(53-47)30-16-8-4-9-17-30/h3-28H,1-2H3/i1D3,2D3 |
| InChIKey | VUDNQKBBTSFRQA-WFGJKAKNSA-N |
| XLogP | 12.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |