C55H37N5O — CID 168832454
8-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-6,6-dimethyl-2-phenylindeno[2,1-g][1,3]benzoxazole (PubChem CID 168832454) has the molecular formula C55H37N5O and a molecular weight of 783.94 g/mol. Its IUPAC name is 8-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-6,6-dimethyl-2-phenylindeno[2,1-g][1,3]benzoxazole.
| Compound Name | 8-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-6,6-dimethyl-2-phenylindeno[2,1-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 168832454 |
| Molecular Formula | C55H37N5O |
| Molecular Weight | 783.94 g/mol |
| Exact Mass | 783.30 |
| IUPAC Name | 8-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-6,6-dimethyl-2-phenylindeno[2,1-g][1,3]benzoxazole |
| SMILES | CC1(C)c2cc(-c3ccc4c(c3)c3ccccc3n4-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc2-c2c1ccc1nc(-c3ccccc3)oc21 |
| InChI | InChI=1S/C55H37N5O/c1-55(2)44-28-29-46-50(61-54(56-46)36-19-10-5-11-20-36)49(44)42-27-25-38(33-45(42)55)37-26-30-48-43(32-37)41-23-12-13-24-47(41)60(48)40-22-14-21-39(31-40)53-58-51(34-15-6-3-7-16-34)57-52(59-53)35-17-8-4-9-18-35/h3-33H,1-2H3 |
| InChIKey | GVKIECYXYNYROV-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.94 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |