C49H23B10N5O — CID 174084470
CID 174084470 (PubChem CID 174084470) has the molecular formula C49H23B10N5O and a molecular weight of 805.88 g/mol.
| Compound Name | CID 174084470 |
|---|---|
| PubChem CID | 174084470 |
| Molecular Formula | C49H23B10N5O |
| Molecular Weight | 805.88 g/mol |
| Exact Mass | 807.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3c([B])c([B])c([B])c([B])c3[B])nc(-n3c4ccccc4c4cc(-c5ccc6c(c5)-c5c(ccc7nc(-c8ccccc8)oc57)C6(C)C)ccc43)n2)c([B])c1[B] |
| InChI | InChI=1S/C49H23B10N5O/c1-49(2)26-14-12-21(19-25(26)31-27(49)15-16-28-44(31)65-47(60-28)20-8-4-3-5-9-20)22-13-17-30-24(18-22)23-10-6-7-11-29(23)64(30)48-62-45(32-34(50)38(54)42(58)39(55)35(32)51)61-46(63-48)33-36(52)40(56)43(59)41(57)37(33)53/h3-19H,1-2H3 |
| InChIKey | PCAFWTLMGQHHRX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.88 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|