C61H40N6O — CID 166583062
2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-1,3-benzoxazole (PubChem CID 166583062) has the molecular formula C61H40N6O and a molecular weight of 873.03 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 166583062 |
| Molecular Formula | C61H40N6O |
| Molecular Weight | 873.03 g/mol |
| Exact Mass | 872.33 |
| IUPAC Name | 2-[4-(9,9-dimethylfluoren-3-yl)phenyl]-7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-1,3-benzoxazole |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccc(-c4nc5cccc(-n6c7ccccc7c7ccc8c9ccccc9n(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c8c76)c5o4)cc3)ccc21 |
| InChI | InChI=1S/C61H40N6O/c1-61(2)48-23-12-9-20-42(48)47-36-41(32-35-49(47)61)37-28-30-40(31-29-37)59-62-50-24-15-27-53(56(50)68-59)66-51-25-13-10-21-43(51)45-33-34-46-44-22-11-14-26-52(44)67(55(46)54(45)66)60-64-57(38-16-5-3-6-17-38)63-58(65-60)39-18-7-4-8-19-39/h3-36H,1-2H3 |
| InChIKey | HGIKRVBKRGSXBG-UHFFFAOYSA-N |
| XLogP | 15.18 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.03 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |