C66H40N6O — CID 166582829
7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,3-benzoxazole (PubChem CID 166582829) has the molecular formula C66H40N6O and a molecular weight of 933.09 g/mol. Its IUPAC name is 7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,3-benzoxazole.
| Compound Name | 7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 166582829 |
| Molecular Formula | C66H40N6O |
| Molecular Weight | 933.09 g/mol |
| Exact Mass | 932.33 |
| IUPAC Name | 7-[12-(4,6-diphenyl-1,3,5-triazin-2-yl)indolo[2,3-a]carbazol-11-yl]-2-[4-(10-phenylanthracen-9-yl)phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6cccc7nc(-c8ccc(-c9c%10ccccc%10c(-c%10ccccc%10)c%10ccccc9%10)cc8)oc67)c5c43)n2)cc1 |
| InChI | InChI=1S/C66H40N6O/c1-4-19-41(20-5-1)58-48-27-10-12-29-50(48)59(51-30-13-11-28-49(51)58)42-35-37-45(38-36-42)65-67-54-31-18-34-57(62(54)73-65)71-55-32-16-14-25-46(55)52-39-40-53-47-26-15-17-33-56(47)72(61(53)60(52)71)66-69-63(43-21-6-2-7-22-43)68-64(70-66)44-23-8-3-9-24-44/h1-40H |
| InChIKey | XJRVWDCZAALDLN-UHFFFAOYSA-N |
| XLogP | 16.85 |
| TPSA | 74.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.09 |
| LogP ≤ 5 | 16.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|