C54H30B5N7 — CID 174289350
CID 174289350 (PubChem CID 174289350) has the molecular formula C54H30B5N7 and a molecular weight of 830.94 g/mol.
| Compound Name | CID 174289350 |
|---|---|
| PubChem CID | 174289350 |
| Molecular Formula | C54H30B5N7 |
| Molecular Weight | 830.94 g/mol |
| Exact Mass | 831.30 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-n3c4ccccc4c4cc(-c5ccccc5)ccc43)n2)c([B])c1[B] |
| InChI | InChI=1S/C54H30B5N7/c55-44-43(45(56)47(58)48(59)46(44)57)54-64-51(34-21-11-4-12-22-34)63-53(65-54)39-30-36(52-61-49(32-17-7-2-8-18-32)60-50(62-52)33-19-9-3-10-20-33)26-28-42(39)66-40-24-14-13-23-37(40)38-29-35(25-27-41(38)66)31-15-5-1-6-16-31/h1-30H |
| InChIKey | WOBKIMKYWOGLNN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.94 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|