About CID 174101001
CID 174101001 (PubChem CID 174101001) has the molecular formula C60H32B5N7
and a molecular weight of 905.02 g/mol.
Molecular Properties
| Compound Name | CID 174101001 |
| PubChem CID | 174101001 |
| Molecular Formula | C60H32B5N7 |
| Molecular Weight | 905.02 g/mol |
| Exact Mass | 905.32 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-n3c4ccccc4c4cc5c6ccccc6c6ccccc6c5cc43)n2)c([B])c1[B] |
| InChI | InChI=1S/C60H32B5N7/c61-50-49(51(62)53(64)54(65)52(50)63)60-70-57(35-20-8-3-9-21-35)69-59(71-60)45-30-36(58-67-55(33-16-4-1-5-17-33)66-56(68-58)34-18-6-2-7-19-34)28-29-47(45)72-46-27-15-14-26-41(46)44-31-42-39-24-12-10-22-37(39)38-23-11-13-25-40(38)43(42)32-48(44)72/h1-32H |
| InChIKey | SMSSOGCZTINJRX-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 72 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 905.02 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 174101001 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174101001?
The IUPAC name of CID 174101001 (CID 174101001) is not available.
What is the SMILES notation for CID 174101001?
The canonical SMILES for CID 174101001 is [B]c1c([B])c([B])c(-c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3-n3c4ccccc4c4cc5c6ccccc6c6ccccc6c5cc43)n2)c([B])c1[B].
What is the InChIKey of CID 174101001?
The InChIKey is SMSSOGCZTINJRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H32B5N7/c61-50-49(51(62)53(64)54(65)52(50)63)60-70-57(35-20-8-3-9-21-35)69-59(71-60)45-30-36(58-67-55(33-16-4-1-5-17-33)66-56(68-58)34-18-6-2-7-19-34)28-29-47(45)72-46-27-15-14-26-41(46)44-31-42-39-24-12-10-22-37(39)38-23-11-13-25-40(38)43(42)32-48(44)72/h1-32H.
What are the key properties of CID 174101001?
CID 174101001 has a molecular weight of 905.02 g/mol, XLogP of 8.58, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174101001 is sourced from PubChem (CID 174101001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).