C58H54B5N5O — CID 174083981
CID 174083981 (PubChem CID 174083981) has the molecular formula C58H54B5N5O and a molecular weight of 891.16 g/mol.
| Compound Name | CID 174083981 |
|---|---|
| PubChem CID | 174083981 |
| Molecular Formula | C58H54B5N5O |
| Molecular Weight | 891.16 g/mol |
| Exact Mass | 891.48 |
| IUPAC Name | — |
| SMILES | [B]/C=C\C=C(/C=C)c1nc(/C([B]C)=C/C=C\C=C)nc(C(=C/[B]C)/C=C(\C)n2c([B]C)c(/C=C\C=C)c(/C=C(\[B]C)c3ccc4c(c3)C(C)(C)c3ccc5nc(-c6ccccc6)oc5c3-4)c2C=C)n1 |
| InChI | InChI=1S/C58H54B5N5O/c1-12-16-19-27-47(61-9)56-66-54(38(14-3)25-22-32-59)65-55(67-56)41(36-60-8)33-37(5)68-50(15-4)44(42(26-17-13-2)53(68)63-11)35-48(62-10)40-28-29-43-46(34-40)58(6,7)45-30-31-49-52(51(43)45)69-57(64-49)39-23-20-18-21-24-39/h12-36H,1-4H2,5-11H3/b19-16-,26-17-,32-22-,37-33+,38-25+,41-36+,47-27-,48-35- |
| InChIKey | LFPXNYXIRBSEOR-IYYBXCLUSA-N |
| XLogP | 13.00 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.16 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|