C47H33N5O — CID 144788535
10-[(2E,4E)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-2,4,6-trien-3-yl]-2,7-diphenyl-[1,3]oxazolo[5,4-a]carbazole (PubChem CID 144788535) has the molecular formula C47H33N5O and a molecular weight of 683.82 g/mol. Its IUPAC name is 10-[(2E,4E)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-2,4,6-trien-3-yl]-2,7-diphenyl-[1,3]oxazolo[5,4-a]carbazole.
| Compound Name | 10-[(2E,4E)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-2,4,6-trien-3-yl]-2,7-diphenyl-[1,3]oxazolo[5,4-a]carbazole |
|---|---|
| PubChem CID | 144788535 |
| Molecular Formula | C47H33N5O |
| Molecular Weight | 683.82 g/mol |
| Exact Mass | 683.27 |
| IUPAC Name | 10-[(2E,4E)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)hepta-2,4,6-trien-3-yl]-2,7-diphenyl-[1,3]oxazolo[5,4-a]carbazole |
| SMILES | C=C/C(=C\C(=C/C)n1c2ccc(-c3ccccc3)cc2c2ccc3nc(-c4ccccc4)oc3c21)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C47H33N5O/c1-3-31(44-49-45(33-19-11-6-12-20-33)51-46(50-44)34-21-13-7-14-22-34)29-37(4-2)52-41-28-25-36(32-17-9-5-10-18-32)30-39(41)38-26-27-40-43(42(38)52)53-47(48-40)35-23-15-8-16-24-35/h3-30H,1H2,2H3/b31-29+,37-4+ |
| InChIKey | LSCSZBYZJUITBR-MIHIQLBNSA-N |
| XLogP | 11.92 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.82 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|