C34H27N3O — CID 155066058
N-[(1E)-2-[9,9-dimethyl-7-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)fluoren-2-yl]buta-1,3-dienyl]ethanimine (PubChem CID 155066058) has the molecular formula C34H27N3O and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[(1E)-2-[9,9-dimethyl-7-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)fluoren-2-yl]buta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-[9,9-dimethyl-7-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)fluoren-2-yl]buta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 155066058 |
| Molecular Formula | C34H27N3O |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[(1E)-2-[9,9-dimethyl-7-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)fluoren-2-yl]buta-1,3-dienyl]ethanimine |
| SMILES | C=C/C(=C\N=C\C)c1ccc2c(c1)C(C)(C)c1cc(-c3ccc4nc5c6ccccc6oc5n4c3)ccc1-2 |
| InChI | InChI=1S/C34H27N3O/c1-5-21(19-35-6-2)22-11-14-25-26-15-12-23(18-29(26)34(3,4)28(25)17-22)24-13-16-31-36-32-27-9-7-8-10-30(27)38-33(32)37(31)20-24/h5-20H,1H2,2-4H3/b21-19+,35-6+ |
| InChIKey | XTFREYOLBZBGRO-XKPHFPESSA-N |
| XLogP | 8.82 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|